C37H72O5Si3 — CID 70441167
8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oct-6-yne-2,5-diol (PubChem CID 70441167) has the molecular formula C37H72O5Si3 and a molecular weight of 681.24 g/mol. Its IUPAC name is 8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oct-6-yne-2,5-diol.
| Compound Name | 8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oct-6-yne-2,5-diol |
|---|---|
| PubChem CID | 70441167 |
| Molecular Formula | C37H72O5Si3 |
| Molecular Weight | 681.24 g/mol |
| Exact Mass | 680.47 |
| IUPAC Name | 8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oct-6-yne-2,5-diol |
| SMILES | CCCCC(C)(C/C=C/[C@@H]1C(CC#CC(O)CCC(C)O)=C(O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C37H72O5Si3/c1-15-19-27-37(9,42-43(10,11)12)28-21-24-33-32(23-20-22-31(39)26-25-30(5)38)34(40-44(13,14)36(6,7)8)29-35(33)41-45(16-2,17-3)18-4/h21,24,30-31,33,35,38-39H,15-19,23,25-29H2,1-14H3/b24-21+/t30?,31?,33-,35-,37?/m1/s1 |
| InChIKey | OUBGNROIDINDCZ-HZVJTOKPSA-N |
| XLogP | 10.33 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.24 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|