About [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate
[3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate (PubChem CID 70441305) has the molecular formula C11H8F2N2O3
and a molecular weight of 254.19 g/mol. Its IUPAC name is [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate |
| PubChem CID | 70441305 |
| Molecular Formula | C11H8F2N2O3 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cncn1Cc1c(F)cccc1F |
| InChI | InChI=1S/C11H8F2N2O3/c12-8-2-1-3-9(13)7(8)5-15-6-14-4-10(15)18-11(16)17/h1-4,6H,5H2,(H,16,17) |
| InChIKey | NCLXUVHFCUASQQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
The IUPAC name of [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate (CID 70441305) is [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate.
What is the SMILES notation for [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
The canonical SMILES for [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate is O=C(O)Oc1cncn1Cc1c(F)cccc1F.
What is the InChIKey of [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
The InChIKey is NCLXUVHFCUASQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O3/c12-8-2-1-3-9(13)7(8)5-15-6-14-4-10(15)18-11(16)17/h1-4,6H,5H2,(H,16,17).
What are the key properties of [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate?
[3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate has a molecular weight of 254.19 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,6-difluorophenyl)methyl]imidazol-4-yl] hydrogen carbonate is sourced from PubChem (CID 70441305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).