About but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide
but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide (PubChem CID 70441558) has the molecular formula C23H26N2O5
and a molecular weight of 410.47 g/mol. Its IUPAC name is but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide.
Molecular Properties
| Compound Name | but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide |
| PubChem CID | 70441558 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide |
| SMILES | CNC(C)CCC1(C(N)=O)c2ccccc2-c2ccccc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H22N2O.C4H4O4/c1-13(21-2)11-12-19(18(20)22)16-9-5-3-7-14(16)15-8-4-6-10-17(15)19;5-3(6)1-2-4(7)8/h3-10,13,21H,11-12H2,1-2H3,(H2,20,22);1-2H,(H,5,6)(H,7,8) |
| InChIKey | CYPCCPFBNMUNNY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide?
The IUPAC name of but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide (CID 70441558) is but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide.
What is the SMILES notation for but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide?
The canonical SMILES for but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide is CNC(C)CCC1(C(N)=O)c2ccccc2-c2ccccc21.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide?
The InChIKey is CYPCCPFBNMUNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O.C4H4O4/c1-13(21-2)11-12-19(18(20)22)16-9-5-3-7-14(16)15-8-4-6-10-17(15)19;5-3(6)1-2-4(7)8/h3-10,13,21H,11-12H2,1-2H3,(H2,20,22);1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide?
but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide has a molecular weight of 410.47 g/mol, XLogP of 2.54, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;9-[3-(methylamino)butyl]fluorene-9-carboxamide is sourced from PubChem (CID 70441558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).