C16H28N2O3 — CID 70441982
1-[(4'R,4'aR,8'aS)-2'-amino-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-yl]ethanone (PubChem CID 70441982) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-[(4'R,4'aR,8'aS)-2'-amino-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-yl]ethanone.
| Compound Name | 1-[(4'R,4'aR,8'aS)-2'-amino-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-yl]ethanone |
|---|---|
| PubChem CID | 70441982 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-[(4'R,4'aR,8'aS)-2'-amino-1'-propylspiro[1,3-dioxolane-2,6'-2,3,4,4a,5,7,8,8a-octahydroquinoline]-4'-yl]ethanone |
| SMILES | CCCN1C(N)C[C@@H](C(C)=O)[C@H]2CC3(CC[C@@H]21)OCCO3 |
| InChI | InChI=1S/C16H28N2O3/c1-3-6-18-14-4-5-16(20-7-8-21-16)10-13(14)12(11(2)19)9-15(18)17/h12-15H,3-10,17H2,1-2H3/t12-,13+,14-,15?/m0/s1 |
| InChIKey | HKPGEPTXZBXFLC-MBOZISHXSA-N |
| XLogP | 1.50 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |