C14H25NOS — CID 70441989
2-(methylsulfanylmethyl)-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-6-one (PubChem CID 70441989) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-6-one.
| Compound Name | 2-(methylsulfanylmethyl)-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-6-one |
|---|---|
| PubChem CID | 70441989 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-(methylsulfanylmethyl)-1-propyl-2,3,4,4a,5,7,8,8a-octahydroquinolin-6-one |
| SMILES | CCCN1C(CSC)CCC2CC(=O)CCC21 |
| InChI | InChI=1S/C14H25NOS/c1-3-8-15-12(10-17-2)5-4-11-9-13(16)6-7-14(11)15/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | SHLOCLJOSJRXSI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |