C18H16Cl4O8 — CID 70442317
3,4,5,6-tetrachloro-1,2-bis(2-oxo-2-prop-2-enoxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 70442317) has the molecular formula C18H16Cl4O8 and a molecular weight of 502.13 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-1,2-bis(2-oxo-2-prop-2-enoxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrachloro-1,2-bis(2-oxo-2-prop-2-enoxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70442317 |
| Molecular Formula | C18H16Cl4O8 |
| Molecular Weight | 502.13 g/mol |
| Exact Mass | 499.96 |
| IUPAC Name | 3,4,5,6-tetrachloro-1,2-bis(2-oxo-2-prop-2-enoxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C=CCOC(=O)CC1(C(=O)O)C(Cl)=C(Cl)C(Cl)=C(Cl)C1(CC(=O)OCC=C)C(=O)O |
| InChI | InChI=1S/C18H16Cl4O8/c1-3-5-29-9(23)7-17(15(25)26)13(21)11(19)12(20)14(22)18(17,16(27)28)8-10(24)30-6-4-2/h3-4H,1-2,5-8H2,(H,25,26)(H,27,28) |
| InChIKey | KJKAMLLDYONAHI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|