C20H28Cl2O2 — CID 70442716
(1R,2S,4S)-2-[(2,4-dichlorophenyl)methoxy]-4-hexyl-1-methyl-7-oxabicyclo[2.2.1]heptane (PubChem CID 70442716) has the molecular formula C20H28Cl2O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is (1R,2S,4S)-2-[(2,4-dichlorophenyl)methoxy]-4-hexyl-1-methyl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S)-2-[(2,4-dichlorophenyl)methoxy]-4-hexyl-1-methyl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 70442716 |
| Molecular Formula | C20H28Cl2O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (1R,2S,4S)-2-[(2,4-dichlorophenyl)methoxy]-4-hexyl-1-methyl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CCCCCC[C@@]12CC[C@@](C)(O1)[C@@H](OCc1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C20H28Cl2O2/c1-3-4-5-6-9-20-11-10-19(2,24-20)18(13-20)23-14-15-7-8-16(21)12-17(15)22/h7-8,12,18H,3-6,9-11,13-14H2,1-2H3/t18-,19+,20-/m0/s1 |
| InChIKey | ZVRLVDJOWBVMOP-ZCNNSNEGSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|