C12H17NO6 — CID 70442744
[(3R,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-3-aminobut-2-enoate (PubChem CID 70442744) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-3-aminobut-2-enoate.
| Compound Name | [(3R,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-3-aminobut-2-enoate |
|---|---|
| PubChem CID | 70442744 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [(3R,3aR,6S,6aR)-3-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (Z)-3-aminobut-2-enoate |
| SMILES | CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)/C=C(/C)N |
| InChI | InChI=1S/C12H17NO6/c1-6(13)3-10(15)19-9-5-17-11-8(18-7(2)14)4-16-12(9)11/h3,8-9,11-12H,4-5,13H2,1-2H3/b6-3-/t8-,9+,11-,12-/m1/s1 |
| InChIKey | WJESXBKAKWHREV-DIORXNCBSA-N |
| XLogP | -0.51 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|