About 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine
4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine (PubChem CID 70442959) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine |
| PubChem CID | 70442959 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine |
| SMILES | CC(CN)C(C)CC1OCCO1 |
| InChI | InChI=1S/C9H19NO2/c1-7(8(2)6-10)5-9-11-3-4-12-9/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | PBFLOCPIDWSYDJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine?
The IUPAC name of 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine (CID 70442959) is 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine is CC(CN)C(C)CC1OCCO1.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine?
The InChIKey is PBFLOCPIDWSYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-7(8(2)6-10)5-9-11-3-4-12-9/h7-9H,3-6,10H2,1-2H3.
What are the key properties of 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine?
4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine has a molecular weight of 173.26 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)-2,3-dimethylbutan-1-amine is sourced from PubChem (CID 70442959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).