About purino[7,8-a]pyrimidine
purino[7,8-a]pyrimidine (PubChem CID 70443161) has the molecular formula C8H5N5
and a molecular weight of 171.16 g/mol. Its IUPAC name is purino[7,8-a]pyrimidine.
Molecular Properties
| Compound Name | purino[7,8-a]pyrimidine |
| PubChem CID | 70443161 |
| Molecular Formula | C8H5N5 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | purino[7,8-a]pyrimidine |
| SMILES | c1cnc2nc3ncncc3n2c1 |
| InChI | InChI=1S/C8H5N5/c1-2-10-8-12-7-6(13(8)3-1)4-9-5-11-7/h1-5H |
| InChIKey | IHYYYZCMJCIECX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze purino[7,8-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of purino[7,8-a]pyrimidine?
The IUPAC name of purino[7,8-a]pyrimidine (CID 70443161) is purino[7,8-a]pyrimidine.
What is the SMILES notation for purino[7,8-a]pyrimidine?
The canonical SMILES for purino[7,8-a]pyrimidine is c1cnc2nc3ncncc3n2c1.
What is the InChIKey of purino[7,8-a]pyrimidine?
The InChIKey is IHYYYZCMJCIECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5/c1-2-10-8-12-7-6(13(8)3-1)4-9-5-11-7/h1-5H.
What are the key properties of purino[7,8-a]pyrimidine?
purino[7,8-a]pyrimidine has a molecular weight of 171.16 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for purino[7,8-a]pyrimidine is sourced from PubChem (CID 70443161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).