About 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol
4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol (PubChem CID 70443582) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 70443582 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC(O)C1=CC=C(O)C(C)(C(C)O)C1 |
| InChI | InChI=1S/C11H18O3/c1-7(12)9-4-5-10(14)11(3,6-9)8(2)13/h4-5,7-8,12-14H,6H2,1-3H3 |
| InChIKey | JGVQWQCAXPTVHW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol (CID 70443582) is 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol is CC(O)C1=CC=C(O)C(C)(C(C)O)C1.
What is the InChIKey of 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is JGVQWQCAXPTVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-7(12)9-4-5-10(14)11(3,6-9)8(2)13/h4-5,7-8,12-14H,6H2,1-3H3.
What are the key properties of 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol?
4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 198.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(1-hydroxyethyl)-6-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 70443582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).