About 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one
3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one (PubChem CID 70443652) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one |
| PubChem CID | 70443652 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one |
| SMILES | C=CCC1=NNC(=O)C1CC=C |
| InChI | InChI=1S/C9H12N2O/c1-3-5-7-8(6-4-2)10-11-9(7)12/h3-4,7H,1-2,5-6H2,(H,11,12) |
| InChIKey | GKXADKWFRPFOOS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one?
The IUPAC name of 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one (CID 70443652) is 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one is C=CCC1=NNC(=O)C1CC=C.
What is the InChIKey of 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one?
The InChIKey is GKXADKWFRPFOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-3-5-7-8(6-4-2)10-11-9(7)12/h3-4,7H,1-2,5-6H2,(H,11,12).
What are the key properties of 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one?
3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one has a molecular weight of 164.21 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(prop-2-enyl)-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 70443652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).