C20H23ClN2O5S — CID 7044367
[2-(2-chloro-4-methylanilino)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 7044367) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7044367 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(C)cc2Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O5S/c1-4-23(5-2)29(26,27)16-8-6-7-15(12-16)20(25)28-13-19(24)22-18-10-9-14(3)11-17(18)21/h6-12H,4-5,13H2,1-3H3,(H,22,24) |
| InChIKey | VEUPINUKMDACRY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |