methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate

C9H12N2O3S — CID 704438

IUPACmethyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate
SMILESCOC(=O)COc1cc(C)nc(SC)n1
InChIInChI=1S/C9H12N2O3S/c1-6-4-7(11-9(10-6)15-3)14-5-8(12)13-2/h4H,5H2,1-3H3
InChIKeyJFJRDVCLSIZCQL-UHFFFAOYSA-N
MW228.27 g/mol
LogP1.06
Rot. Bonds4

About methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate

methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate (PubChem CID 704438) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate.

Molecular Properties

Compound Namemethyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate
PubChem CID704438
Molecular FormulaC9H12N2O3S
Molecular Weight228.27 g/mol
Exact Mass228.06
IUPAC Namemethyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate
SMILESCOC(=O)COc1cc(C)nc(SC)n1
InChIInChI=1S/C9H12N2O3S/c1-6-4-7(11-9(10-6)15-3)14-5-8(12)13-2/h4H,5H2,1-3H3
InChIKeyJFJRDVCLSIZCQL-UHFFFAOYSA-N
XLogP1.06
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.27
LogP ≤ 51.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate?
The IUPAC name of methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate (CID 704438) is methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate.
What is the SMILES notation for methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate?
The canonical SMILES for methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate is COC(=O)COc1cc(C)nc(SC)n1.
What is the InChIKey of methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate?
The InChIKey is JFJRDVCLSIZCQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-6-4-7(11-9(10-6)15-3)14-5-8(12)13-2/h4H,5H2,1-3H3.
What are the key properties of methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate?
methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate has a molecular weight of 228.27 g/mol, XLogP of 1.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-methyl-2-methylsulfanylpyrimidin-4-yl)oxyacetate is sourced from PubChem (CID 704438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).