About (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate
(7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate (PubChem CID 70443963) has the molecular formula C14H13FO5
and a molecular weight of 280.25 g/mol. Its IUPAC name is (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate |
| PubChem CID | 70443963 |
| Molecular Formula | C14H13FO5 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate |
| SMILES | COc1cc2ccc(F)cc2c(OC(=O)CO)c1OC |
| InChI | InChI=1S/C14H13FO5/c1-18-11-5-8-3-4-9(15)6-10(8)13(14(11)19-2)20-12(17)7-16/h3-6,16H,7H2,1-2H3 |
| InChIKey | AJHUPOJRKMFILS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate?
The IUPAC name of (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate (CID 70443963) is (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate.
What is the SMILES notation for (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate?
The canonical SMILES for (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate is COc1cc2ccc(F)cc2c(OC(=O)CO)c1OC.
What is the InChIKey of (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate?
The InChIKey is AJHUPOJRKMFILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FO5/c1-18-11-5-8-3-4-9(15)6-10(8)13(14(11)19-2)20-12(17)7-16/h3-6,16H,7H2,1-2H3.
What are the key properties of (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate?
(7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate has a molecular weight of 280.25 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-2,3-dimethoxynaphthalen-1-yl) 2-hydroxyacetate is sourced from PubChem (CID 70443963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).