C16H7Cl4NO2 — CID 70444114
3,4,5,6-tetrachloro-3-(1H-indol-2-yl)-2-benzofuran-1-one (PubChem CID 70444114) has the molecular formula C16H7Cl4NO2 and a molecular weight of 387.05 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-3-(1H-indol-2-yl)-2-benzofuran-1-one.
| Compound Name | 3,4,5,6-tetrachloro-3-(1H-indol-2-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 70444114 |
| Molecular Formula | C16H7Cl4NO2 |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | 3,4,5,6-tetrachloro-3-(1H-indol-2-yl)-2-benzofuran-1-one |
| SMILES | O=C1OC(Cl)(c2cc3ccccc3[nH]2)c2c1cc(Cl)c(Cl)c2Cl |
| InChI | InChI=1S/C16H7Cl4NO2/c17-9-6-8-12(14(19)13(9)18)16(20,23-15(8)22)11-5-7-3-1-2-4-10(7)21-11/h1-6,21H |
| InChIKey | XSFJWUULAKBFSN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|