About [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate
[5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate (PubChem CID 70444483) has the molecular formula C16H14O7S
and a molecular weight of 350.35 g/mol. Its IUPAC name is [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate |
| PubChem CID | 70444483 |
| Molecular Formula | C16H14O7S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate |
| SMILES | Cc1ccc(S(=O)(=O)c2cc3c(cc2C)OC(OC(=O)O)O3)cc1 |
| InChI | InChI=1S/C16H14O7S/c1-9-3-5-11(6-4-9)24(19,20)14-8-13-12(7-10(14)2)21-16(22-13)23-15(17)18/h3-8,16H,1-2H3,(H,17,18) |
| InChIKey | WATVCPYIUQRJLN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
The IUPAC name of [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate (CID 70444483) is [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate.
What is the SMILES notation for [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
The canonical SMILES for [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate is Cc1ccc(S(=O)(=O)c2cc3c(cc2C)OC(OC(=O)O)O3)cc1.
What is the InChIKey of [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
The InChIKey is WATVCPYIUQRJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O7S/c1-9-3-5-11(6-4-9)24(19,20)14-8-13-12(7-10(14)2)21-16(22-13)23-15(17)18/h3-8,16H,1-2H3,(H,17,18).
What are the key properties of [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
[5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate has a molecular weight of 350.35 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-6-(4-methylphenyl)sulfonyl-1,3-benzodioxol-2-yl] hydrogen carbonate is sourced from PubChem (CID 70444483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).