About [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate
[5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate (PubChem CID 70444511) has the molecular formula C16H14O8S
and a molecular weight of 366.35 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate |
| PubChem CID | 70444511 |
| Molecular Formula | C16H14O8S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate |
| SMILES | COc1ccc(S(=O)(=O)c2cc3c(cc2C)OC(OC(=O)O)O3)cc1 |
| InChI | InChI=1S/C16H14O8S/c1-9-7-12-13(23-16(22-12)24-15(17)18)8-14(9)25(19,20)11-5-3-10(21-2)4-6-11/h3-8,16H,1-2H3,(H,17,18) |
| InChIKey | SVJQSSUSBDVKAU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
The IUPAC name of [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate (CID 70444511) is [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate.
What is the SMILES notation for [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
The canonical SMILES for [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate is COc1ccc(S(=O)(=O)c2cc3c(cc2C)OC(OC(=O)O)O3)cc1.
What is the InChIKey of [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
The InChIKey is SVJQSSUSBDVKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O8S/c1-9-7-12-13(23-16(22-12)24-15(17)18)8-14(9)25(19,20)11-5-3-10(21-2)4-6-11/h3-8,16H,1-2H3,(H,17,18).
What are the key properties of [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate?
[5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate has a molecular weight of 366.35 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methoxyphenyl)sulfonyl-6-methyl-1,3-benzodioxol-2-yl] hydrogen carbonate is sourced from PubChem (CID 70444511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).