C14H15NO2S — CID 70444601
5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)pyrrolidine-2,4-dione (PubChem CID 70444601) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)pyrrolidine-2,4-dione.
| Compound Name | 5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 70444601 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 5-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)pyrrolidine-2,4-dione |
| SMILES | O=C1CC(=O)C(Sc2ccc3c(c2)CCCC3)N1 |
| InChI | InChI=1S/C14H15NO2S/c16-12-8-13(17)15-14(12)18-11-6-5-9-3-1-2-4-10(9)7-11/h5-7,14H,1-4,8H2,(H,15,17) |
| InChIKey | IYWLEOYTUAQBPO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|