About (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate
(4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate (PubChem CID 70444705) has the molecular formula C10H18N2O5S
and a molecular weight of 278.33 g/mol. Its IUPAC name is (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate.
Molecular Properties
| Compound Name | (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate |
| PubChem CID | 70444705 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate |
| SMILES | CC[NH+](CCO)c1ccc([NH3+])cc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C10H16N2O.H2O4S/c1-2-12(7-8-13)10-5-3-9(11)4-6-10;1-5(2,3)4/h3-6,13H,2,7-8,11H2,1H3;(H2,1,2,3,4) |
| InChIKey | KAJALVWKFPQZOO-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate?
The IUPAC name of (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate (CID 70444705) is (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate.
What is the SMILES notation for (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate?
The canonical SMILES for (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate is CC[NH+](CCO)c1ccc([NH3+])cc1.O=S(=O)([O-])[O-].
What is the InChIKey of (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate?
The InChIKey is KAJALVWKFPQZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O.H2O4S/c1-2-12(7-8-13)10-5-3-9(11)4-6-10;1-5(2,3)4/h3-6,13H,2,7-8,11H2,1H3;(H2,1,2,3,4).
What are the key properties of (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate?
(4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate has a molecular weight of 278.33 g/mol, XLogP of -2.25, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azaniumylphenyl)-ethyl-(2-hydroxyethyl)azanium sulfate is sourced from PubChem (CID 70444705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).