C28H37NO4 — CID 70444887
dibenzyl 2-amino-2-(3-tert-butyl-4,4-dimethylpent-1-enyl)propanedioate (PubChem CID 70444887) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is dibenzyl 2-amino-2-(3-tert-butyl-4,4-dimethylpent-1-enyl)propanedioate.
| Compound Name | dibenzyl 2-amino-2-(3-tert-butyl-4,4-dimethylpent-1-enyl)propanedioate |
|---|---|
| PubChem CID | 70444887 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | dibenzyl 2-amino-2-(3-tert-butyl-4,4-dimethylpent-1-enyl)propanedioate |
| SMILES | CC(C)(C)C(C=CC(N)(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO4/c1-26(2,3)23(27(4,5)6)17-18-28(29,24(30)32-19-21-13-9-7-10-14-21)25(31)33-20-22-15-11-8-12-16-22/h7-18,23H,19-20,29H2,1-6H3 |
| InChIKey | YQBMILGZLSUUAO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|