About 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole
4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole (PubChem CID 70445332) has the molecular formula C21H15N5OS
and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole |
| PubChem CID | 70445332 |
| Molecular Formula | C21H15N5OS |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(-c3cscn3)nc2c1.c1coc(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C11H8N2O.C10H7N3S/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10;1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-7H,(H,12,13);1-6H,(H,12,13) |
| InChIKey | FSDSWSVZXFPXEW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole?
The IUPAC name of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole (CID 70445332) is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole.
What is the SMILES notation for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole?
The canonical SMILES for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole is c1ccc2[nH]c(-c3cscn3)nc2c1.c1coc(-c2nc3ccccc3[nH]2)c1.
What is the InChIKey of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole?
The InChIKey is FSDSWSVZXFPXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O.C10H7N3S/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10;1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-7H,(H,12,13);1-6H,(H,12,13).
What are the key properties of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole?
4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole has a molecular weight of 385.45 g/mol, XLogP of 5.51, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2-(furan-2-yl)-1H-benzimidazole is sourced from PubChem (CID 70445332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).