C27H37BrO7 — CID 70446434
[2-[(8S,9R,10S,13S,14S,17R)-9-bromo-11-hydroxy-17-(methoxymethoxy)-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70446434) has the molecular formula C27H37BrO7 and a molecular weight of 553.49 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-9-bromo-11-hydroxy-17-(methoxymethoxy)-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-9-bromo-11-hydroxy-17-(methoxymethoxy)-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70446434 |
| Molecular Formula | C27H37BrO7 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-9-bromo-11-hydroxy-17-(methoxymethoxy)-6,10,13,16-tetramethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | COCO[C@]1(C(=O)COC(C)=O)C(C)C[C@H]2[C@@H]3CC(C)C4=CC(=O)C=C[C@]4(C)[C@@]3(Br)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H37BrO7/c1-15-9-21-20-10-16(2)27(35-14-33-6,23(32)13-34-17(3)29)25(20,5)12-22(31)26(21,28)24(4)8-7-18(30)11-19(15)24/h7-8,11,15-16,20-22,31H,9-10,12-14H2,1-6H3/t15?,16?,20-,21-,22?,24-,25-,26-,27-/m0/s1 |
| InChIKey | NLLVQCRXJKXKSZ-CGNDESGBSA-N |
| XLogP | 3.77 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|