C11H17NO5S3 — CID 70446569
6-(2-methoxyethoxymethoxy)-6,7-dihydro-5H-thieno[3,2-b]thiopyran-2-sulfonamide (PubChem CID 70446569) has the molecular formula C11H17NO5S3 and a molecular weight of 339.46 g/mol. Its IUPAC name is 6-(2-methoxyethoxymethoxy)-6,7-dihydro-5H-thieno[3,2-b]thiopyran-2-sulfonamide.
| Compound Name | 6-(2-methoxyethoxymethoxy)-6,7-dihydro-5H-thieno[3,2-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 70446569 |
| Molecular Formula | C11H17NO5S3 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 6-(2-methoxyethoxymethoxy)-6,7-dihydro-5H-thieno[3,2-b]thiopyran-2-sulfonamide |
| SMILES | COCCOCOC1CSc2cc(S(N)(=O)=O)sc2C1 |
| InChI | InChI=1S/C11H17NO5S3/c1-15-2-3-16-7-17-8-4-10-9(18-6-8)5-11(19-10)20(12,13)14/h5,8H,2-4,6-7H2,1H3,(H2,12,13,14) |
| InChIKey | CBYUQQASNJVYJU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|