C24H30O6 — CID 70446664
(2R,3S,4R,5R)-1-[3-ethyl-8-(2-ethylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol (PubChem CID 70446664) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-[3-ethyl-8-(2-ethylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4R,5R)-1-[3-ethyl-8-(2-ethylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 70446664 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2R,3S,4R,5R)-1-[3-ethyl-8-(2-ethylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol |
| SMILES | CCc1ccc2c(c1)C(c1ccccc1CC)C2=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H30O6/c1-3-13-9-10-16-17(11-13)19(15-8-6-5-7-14(15)4-2)20(16)22(28)24(30)23(29)21(27)18(26)12-25/h5-11,18-19,21,23-30H,3-4,12H2,1-2H3/t18-,19?,21-,23+,24+/m1/s1 |
| InChIKey | FKSFRHDOCGXVBE-JMGPHZNDSA-N |
| XLogP | 1.66 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|