C27H31NO3 — CID 70446938
(3S)-4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-2,3-diphenylbutane-1,3-diol (PubChem CID 70446938) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is (3S)-4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-2,3-diphenylbutane-1,3-diol.
| Compound Name | (3S)-4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-2,3-diphenylbutane-1,3-diol |
|---|---|
| PubChem CID | 70446938 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (3S)-4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-2,3-diphenylbutane-1,3-diol |
| SMILES | COc1ccc2c(c1)CC(NC[C@@](O)(c1ccccc1)C(CO)c1ccccc1)CC2 |
| InChI | InChI=1S/C27H31NO3/c1-31-25-15-13-20-12-14-24(16-22(20)17-25)28-19-27(30,23-10-6-3-7-11-23)26(18-29)21-8-4-2-5-9-21/h2-11,13,15,17,24,26,28-30H,12,14,16,18-19H2,1H3/t24?,26?,27-/m1/s1 |
| InChIKey | QDRFPHRPQFWCOH-CQSBDTAJSA-N |
| XLogP | 3.81 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |