C14H25N5O5 — CID 70447058
cyclohexane-1,2-dicarboxamide;propane-1,2,3-tricarboxamide (PubChem CID 70447058) has the molecular formula C14H25N5O5 and a molecular weight of 343.38 g/mol. Its IUPAC name is cyclohexane-1,2-dicarboxamide;propane-1,2,3-tricarboxamide.
| Compound Name | cyclohexane-1,2-dicarboxamide;propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 70447058 |
| Molecular Formula | C14H25N5O5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | cyclohexane-1,2-dicarboxamide;propane-1,2,3-tricarboxamide |
| SMILES | NC(=O)C1CCCCC1C(N)=O.NC(=O)CC(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C8H14N2O2.C6H11N3O3/c9-7(11)5-3-1-2-4-6(5)8(10)12;7-4(10)1-3(6(9)12)2-5(8)11/h5-6H,1-4H2,(H2,9,11)(H2,10,12);3H,1-2H2,(H2,7,10)(H2,8,11)(H2,9,12) |
| InChIKey | IYVYXVTYMGFIRD-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 215.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |