C22H26ClFN4O5 — CID 70447743
[7-[4-(4-chlorobutylcarbamoyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 70447743) has the molecular formula C22H26ClFN4O5 and a molecular weight of 480.92 g/mol. Its IUPAC name is [7-[4-(4-chlorobutylcarbamoyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [7-[4-(4-chlorobutylcarbamoyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70447743 |
| Molecular Formula | C22H26ClFN4O5 |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [7-[4-(4-chlorobutylcarbamoyl)piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(C2CC2)c2cc(N3CCN(C(=O)NCCCCCl)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C22H26ClFN4O5/c23-5-1-2-6-25-21(30)27-9-7-26(8-10-27)18-12-17-15(11-16(18)24)20(29)19(33-22(31)32)13-28(17)14-3-4-14/h11-14H,1-10H2,(H,25,30)(H,31,32) |
| InChIKey | RZIQGTYLZWAQLA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|