C19H17FN4O2 — CID 70447745
3-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 70447745) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 70447745 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(4-nitrophenyl)methyl]-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Cn2nc(-c3ccc(F)cc3)c3c2CCNC3)cc1 |
| InChI | InChI=1S/C19H17FN4O2/c20-15-5-3-14(4-6-15)19-17-11-21-10-9-18(17)23(22-19)12-13-1-7-16(8-2-13)24(25)26/h1-8,21H,9-12H2 |
| InChIKey | HOTZEPNWHMLULE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|