C15H11N5 — CID 70447996
6-naphthalen-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine (PubChem CID 70447996) has the molecular formula C15H11N5 and a molecular weight of 261.29 g/mol. Its IUPAC name is 6-naphthalen-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine.
| Compound Name | 6-naphthalen-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
|---|---|
| PubChem CID | 70447996 |
| Molecular Formula | C15H11N5 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-naphthalen-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
| SMILES | Nc1nnc2ccc(-c3cccc4ccccc34)nn12 |
| InChI | InChI=1S/C15H11N5/c16-15-18-17-14-9-8-13(19-20(14)15)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H2,16,18) |
| InChIKey | QMFSIFOCQRPSBG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |