About 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid
1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 70448389) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 70448389 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | COC1=CC=CC(OC)(C(=O)O)C1 |
| InChI | InChI=1S/C9H12O4/c1-12-7-4-3-5-9(6-7,13-2)8(10)11/h3-5H,6H2,1-2H3,(H,10,11) |
| InChIKey | XSFKFBNQLMQTAL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid (CID 70448389) is 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid is COC1=CC=CC(OC)(C(=O)O)C1.
What is the InChIKey of 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is XSFKFBNQLMQTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-12-7-4-3-5-9(6-7,13-2)8(10)11/h3-5H,6H2,1-2H3,(H,10,11).
What are the key properties of 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid?
1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 184.19 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethoxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 70448389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).