C21H18N2O8 — CID 70448396
[(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl] hydrogen carbonate (PubChem CID 70448396) has the molecular formula C21H18N2O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is [(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl] hydrogen carbonate.
| Compound Name | [(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70448396 |
| Molecular Formula | C21H18N2O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [(2S,3S)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-2-yl] hydrogen carbonate |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N3C(=O)c4ccccc4C3=O)[C@@H]2OC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C21H18N2O8/c1-29-12-8-7-11(15(9-12)30-2)10-22-19(26)16(20(22)31-21(27)28)23-17(24)13-5-3-4-6-14(13)18(23)25/h3-9,16,20H,10H2,1-2H3,(H,27,28)/t16-,20+/m1/s1 |
| InChIKey | UUYVJBJFELWNCJ-UZLBHIALSA-N |
| XLogP | 1.73 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|