About methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate
methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate (PubChem CID 70448568) has the molecular formula C26H23N5O3
and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate |
| PubChem CID | 70448568 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cnnn1[C@H]1NC(=O)[C@H]1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23N5O3/c1-34-25(33)21-17-27-30-31(21)23-22(24(32)28-23)29-26(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,22-23,29H,1H3,(H,28,32)/t22-,23+/m0/s1 |
| InChIKey | YOCMISUAJQCOJF-XZOQPEGZSA-N |
| XLogP | 2.64 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
The IUPAC name of methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate (CID 70448568) is methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate.
What is the SMILES notation for methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
The canonical SMILES for methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate is COC(=O)c1cnnn1[C@H]1NC(=O)[C@H]1NC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
The InChIKey is YOCMISUAJQCOJF-XZOQPEGZSA-N. The full InChI is InChI=1S/C26H23N5O3/c1-34-25(33)21-17-27-30-31(21)23-22(24(32)28-23)29-26(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,22-23,29H,1H3,(H,28,32)/t22-,23+/m0/s1.
What are the key properties of methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate?
methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate has a molecular weight of 453.50 g/mol, XLogP of 2.64, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2R,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]triazole-4-carboxylate is sourced from PubChem (CID 70448568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).