C19H23NO — CID 70448623
(1S,2S,4S)-2-amino-4-[(4-phenylphenyl)methyl]cyclohexan-1-ol (PubChem CID 70448623) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (1S,2S,4S)-2-amino-4-[(4-phenylphenyl)methyl]cyclohexan-1-ol.
| Compound Name | (1S,2S,4S)-2-amino-4-[(4-phenylphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 70448623 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (1S,2S,4S)-2-amino-4-[(4-phenylphenyl)methyl]cyclohexan-1-ol |
| SMILES | N[C@H]1C[C@H](Cc2ccc(-c3ccccc3)cc2)CC[C@@H]1O |
| InChI | InChI=1S/C19H23NO/c20-18-13-15(8-11-19(18)21)12-14-6-9-17(10-7-14)16-4-2-1-3-5-16/h1-7,9-10,15,18-19,21H,8,11-13,20H2/t15-,18-,19-/m0/s1 |
| InChIKey | ZGJFECVPFNMWEU-SNRMKQJTSA-N |
| XLogP | 3.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |