About 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol
4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol (PubChem CID 70448692) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol |
| PubChem CID | 70448692 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol |
| SMILES | OC1CCC(C2OCCO2)CC1O |
| InChI | InChI=1S/C9H16O4/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h6-11H,1-5H2 |
| InChIKey | NRPXECNFXRLRHB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol?
The IUPAC name of 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol (CID 70448692) is 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol is OC1CCC(C2OCCO2)CC1O.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol?
The InChIKey is NRPXECNFXRLRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h6-11H,1-5H2.
What are the key properties of 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol?
4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol has a molecular weight of 188.22 g/mol, XLogP of -0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)cyclohexane-1,2-diol is sourced from PubChem (CID 70448692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).