C19H24ClNO — CID 70448694
(1R,2R,5R)-2-amino-5-[(4-phenylphenyl)methyl]cyclohexan-1-ol;hydrochloride (PubChem CID 70448694) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is (1R,2R,5R)-2-amino-5-[(4-phenylphenyl)methyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | (1R,2R,5R)-2-amino-5-[(4-phenylphenyl)methyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 70448694 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (1R,2R,5R)-2-amino-5-[(4-phenylphenyl)methyl]cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H]1CC[C@H](Cc2ccc(-c3ccccc3)cc2)C[C@H]1O |
| InChI | InChI=1S/C19H23NO.ClH/c20-18-11-8-15(13-19(18)21)12-14-6-9-17(10-7-14)16-4-2-1-3-5-16;/h1-7,9-10,15,18-19,21H,8,11-13,20H2;1H/t15-,18-,19-;/m1./s1 |
| InChIKey | QFUPTCHQLKTEAS-UJFDOPBTSA-N |
| XLogP | 3.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |