C11H10N6 — CID 70448780
6-(4-aminophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-amine (PubChem CID 70448780) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-(4-aminophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-amine.
| Compound Name | 6-(4-aminophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
|---|---|
| PubChem CID | 70448780 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-(4-aminophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-amine |
| SMILES | Nc1ccc(-c2ccc3nnc(N)n3n2)cc1 |
| InChI | InChI=1S/C11H10N6/c12-8-3-1-7(2-4-8)9-5-6-10-14-15-11(13)17(10)16-9/h1-6H,12H2,(H2,13,15) |
| InChIKey | RYFALDHNEPTXIF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|