About 2,3,4-trifluoroquinoline
2,3,4-trifluoroquinoline (PubChem CID 70448794) has the molecular formula C9H4F3N
and a molecular weight of 183.13 g/mol. Its IUPAC name is 2,3,4-trifluoroquinoline.
Molecular Properties
| Compound Name | 2,3,4-trifluoroquinoline |
| PubChem CID | 70448794 |
| Molecular Formula | C9H4F3N |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 2,3,4-trifluoroquinoline |
| SMILES | Fc1nc2ccccc2c(F)c1F |
| InChI | InChI=1S/C9H4F3N/c10-7-5-3-1-2-4-6(5)13-9(12)8(7)11/h1-4H |
| InChIKey | VMRCHEBYEJBVOS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trifluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trifluoroquinoline?
The IUPAC name of 2,3,4-trifluoroquinoline (CID 70448794) is 2,3,4-trifluoroquinoline.
What is the SMILES notation for 2,3,4-trifluoroquinoline?
The canonical SMILES for 2,3,4-trifluoroquinoline is Fc1nc2ccccc2c(F)c1F.
What is the InChIKey of 2,3,4-trifluoroquinoline?
The InChIKey is VMRCHEBYEJBVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3N/c10-7-5-3-1-2-4-6(5)13-9(12)8(7)11/h1-4H.
What are the key properties of 2,3,4-trifluoroquinoline?
2,3,4-trifluoroquinoline has a molecular weight of 183.13 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trifluoroquinoline is sourced from PubChem (CID 70448794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).