About [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate
[4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate (PubChem CID 70448821) has the molecular formula C19H17ClN2O3
and a molecular weight of 356.81 g/mol. Its IUPAC name is [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate.
Molecular Properties
| Compound Name | [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate |
| PubChem CID | 70448821 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(c2ccccc2)=NC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-12-17(25-19(23)24-2)16(14-9-6-10-15(20)11-14)22-18(21-12)13-7-4-3-5-8-13/h3-11,16H,1-2H3,(H,21,22) |
| InChIKey | FVRQIPUDMNZNOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate?
The IUPAC name of [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate (CID 70448821) is [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate.
What is the SMILES notation for [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate?
The canonical SMILES for [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate is COC(=O)OC1=C(C)NC(c2ccccc2)=NC1c1cccc(Cl)c1.
What is the InChIKey of [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate?
The InChIKey is FVRQIPUDMNZNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O3/c1-12-17(25-19(23)24-2)16(14-9-6-10-15(20)11-14)22-18(21-12)13-7-4-3-5-8-13/h3-11,16H,1-2H3,(H,21,22).
What are the key properties of [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate?
[4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate has a molecular weight of 356.81 g/mol, XLogP of 4.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-chlorophenyl)-6-methyl-2-phenyl-1,4-dihydropyrimidin-5-yl] methyl carbonate is sourced from PubChem (CID 70448821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).