About 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione
2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione (PubChem CID 70449155) has the molecular formula C17H8F2N4O2
and a molecular weight of 338.27 g/mol. Its IUPAC name is 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione.
Molecular Properties
| Compound Name | 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione |
| PubChem CID | 70449155 |
| Molecular Formula | C17H8F2N4O2 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(F)c(F)c2Nc1ccnnn1 |
| InChI | InChI=1S/C17H8F2N4O2/c18-11-7-10-13(15(14(11)19)21-12-5-6-20-23-22-12)17(25)9-4-2-1-3-8(9)16(10)24/h1-7H,(H,20,21,22) |
| InChIKey | QIXQTNKLUCNHMX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione?
The IUPAC name of 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione (CID 70449155) is 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione.
What is the SMILES notation for 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione?
The canonical SMILES for 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione is O=C1c2ccccc2C(=O)c2c1cc(F)c(F)c2Nc1ccnnn1.
What is the InChIKey of 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione?
The InChIKey is QIXQTNKLUCNHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8F2N4O2/c18-11-7-10-13(15(14(11)19)21-12-5-6-20-23-22-12)17(25)9-4-2-1-3-8(9)16(10)24/h1-7H,(H,20,21,22).
What are the key properties of 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione?
2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione has a molecular weight of 338.27 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-1-(triazin-4-ylamino)anthracene-9,10-dione is sourced from PubChem (CID 70449155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).