C16H13BrO2 — CID 70449454
10-(2-bromophenoxy)deca-2,5,8-triyn-1-ol (PubChem CID 70449454) has the molecular formula C16H13BrO2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 10-(2-bromophenoxy)deca-2,5,8-triyn-1-ol.
| Compound Name | 10-(2-bromophenoxy)deca-2,5,8-triyn-1-ol |
|---|---|
| PubChem CID | 70449454 |
| Molecular Formula | C16H13BrO2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 10-(2-bromophenoxy)deca-2,5,8-triyn-1-ol |
| SMILES | OCC#CCC#CCC#CCOc1ccccc1Br |
| InChI | InChI=1S/C16H13BrO2/c17-15-11-7-8-12-16(15)19-14-10-6-4-2-1-3-5-9-13-18/h7-8,11-12,18H,3-4,13-14H2 |
| InChIKey | YRUGVOKYEHSKHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|