C25H35NO5 — CID 70449992
(3aS,7aS)-1-[(4R)-4-ethoxycarbonyl-4-methyl-6-phenylhexanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-3-carboxylic acid (PubChem CID 70449992) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is (3aS,7aS)-1-[(4R)-4-ethoxycarbonyl-4-methyl-6-phenylhexanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-3-carboxylic acid.
| Compound Name | (3aS,7aS)-1-[(4R)-4-ethoxycarbonyl-4-methyl-6-phenylhexanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 70449992 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (3aS,7aS)-1-[(4R)-4-ethoxycarbonyl-4-methyl-6-phenylhexanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-3-carboxylic acid |
| SMILES | CCOC(=O)[C@@](C)(CCC(=O)N1CC(C(=O)O)[C@@H]2CCCC[C@@H]21)CCc1ccccc1 |
| InChI | InChI=1S/C25H35NO5/c1-3-31-24(30)25(2,15-13-18-9-5-4-6-10-18)16-14-22(27)26-17-20(23(28)29)19-11-7-8-12-21(19)26/h4-6,9-10,19-21H,3,7-8,11-17H2,1-2H3,(H,28,29)/t19-,20?,21-,25+/m0/s1 |
| InChIKey | KJKDTWKTURQKPV-GYNMQOMHSA-N |
| XLogP | 4.07 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |