C24H40N6O3S — CID 70449998
4-butyl-1,1-dioxo-3-N-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propyl]-2,3-dihydro-1,2,4,6-thiatriazine-3,5-diamine (PubChem CID 70449998) has the molecular formula C24H40N6O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is 4-butyl-1,1-dioxo-3-N-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propyl]-2,3-dihydro-1,2,4,6-thiatriazine-3,5-diamine.
| Compound Name | 4-butyl-1,1-dioxo-3-N-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propyl]-2,3-dihydro-1,2,4,6-thiatriazine-3,5-diamine |
|---|---|
| PubChem CID | 70449998 |
| Molecular Formula | C24H40N6O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 4-butyl-1,1-dioxo-3-N-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propyl]-2,3-dihydro-1,2,4,6-thiatriazine-3,5-diamine |
| SMILES | CCCCN1C(N)=NS(=O)(=O)NC1NCCCOc1cccc2c1CCCC2N1CCCCC1 |
| InChI | InChI=1S/C24H40N6O3S/c1-2-3-17-30-23(25)27-34(31,32)28-24(30)26-14-9-18-33-22-13-8-10-19-20(22)11-7-12-21(19)29-15-5-4-6-16-29/h8,10,13,21,24,26,28H,2-7,9,11-12,14-18H2,1H3,(H2,25,27) |
| InChIKey | AJZKJDMXAMVCOE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|