C17H30O3 — CID 70450065
ethyl 2-hydroxy-2-pentyl-1-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 70450065) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-pentyl-1-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | ethyl 2-hydroxy-2-pentyl-1-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70450065 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | ethyl 2-hydroxy-2-pentyl-1-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)CCCCC1(O)CCCCC |
| InChI | InChI=1S/C17H30O3/c1-4-7-8-13-17(19)14-10-9-12-16(17,11-5-2)15(18)20-6-3/h5,19H,2,4,6-14H2,1,3H3 |
| InChIKey | MCXQTCGVJPMYRZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|