About 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid
4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 70450276) has the molecular formula C25H34N2O2
and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid |
| PubChem CID | 70450276 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | N#CCCC1CCC(C2(C3(CCC#N)CCCCC3)C=CC(C(=O)O)C=C2)CC1 |
| InChI | InChI=1S/C25H34N2O2/c26-18-4-6-20-7-9-22(10-8-20)25(16-11-21(12-17-25)23(28)29)24(15-5-19-27)13-2-1-3-14-24/h11-12,16-17,20-22H,1-10,13-15H2,(H,28,29) |
| InChIKey | VHUUANJIHHLOEB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid?
The IUPAC name of 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid (CID 70450276) is 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid?
The canonical SMILES for 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid is N#CCCC1CCC(C2(C3(CCC#N)CCCCC3)C=CC(C(=O)O)C=C2)CC1.
What is the InChIKey of 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid?
The InChIKey is VHUUANJIHHLOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N2O2/c26-18-4-6-20-7-9-22(10-8-20)25(16-11-21(12-17-25)23(28)29)24(15-5-19-27)13-2-1-3-14-24/h11-12,16-17,20-22H,1-10,13-15H2,(H,28,29).
What are the key properties of 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid?
4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid has a molecular weight of 394.56 g/mol, XLogP of 6.16, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-cyanoethyl)cyclohexyl]-4-[4-(2-cyanoethyl)cyclohexyl]cyclohexa-2,5-diene-1-carboxylic acid is sourced from PubChem (CID 70450276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).