C36H71N9O2 — CID 70450440
6-[[4-[(4-amino-2-methylbutan-2-yl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]hexan-1-ol (PubChem CID 70450440) has the molecular formula C36H71N9O2 and a molecular weight of 662.02 g/mol. Its IUPAC name is 6-[[4-[(4-amino-2-methylbutan-2-yl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]hexan-1-ol.
| Compound Name | 6-[[4-[(4-amino-2-methylbutan-2-yl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 70450440 |
| Molecular Formula | C36H71N9O2 |
| Molecular Weight | 662.02 g/mol |
| Exact Mass | 661.57 |
| IUPAC Name | 6-[[4-[(4-amino-2-methylbutan-2-yl)-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-[3-methoxypropyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]hexan-1-ol |
| SMILES | COCCCN(c1nc(NCCCCCCO)nc(N(C2CC(C)(C)NC(C)(C)C2)C(C)(C)CCN)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C36H71N9O2/c1-32(2)23-27(24-33(3,4)42-32)44(20-16-22-47-11)30-39-29(38-19-14-12-13-15-21-46)40-31(41-30)45(36(9,10)17-18-37)28-25-34(5,6)43-35(7,8)26-28/h27-28,42-43,46H,12-26,37H2,1-11H3,(H,38,39,40,41) |
| InChIKey | LMRAQJMNILLNMI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.02 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|