About [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate
[3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate (PubChem CID 70450695) has the molecular formula C19H16F3N3O4S
and a molecular weight of 439.42 g/mol. Its IUPAC name is [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate.
Molecular Properties
| Compound Name | [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate |
| PubChem CID | 70450695 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate |
| SMILES | CCC(=O)Oc1[nH]c2c(C(F)(F)F)cccc2c(=O)c1C(=O)N(CC)c1nccs1 |
| InChI | InChI=1S/C19H16F3N3O4S/c1-3-12(26)29-16-13(17(28)25(4-2)18-23-8-9-30-18)15(27)10-6-5-7-11(14(10)24-16)19(20,21)22/h5-9H,3-4H2,1-2H3,(H,24,27) |
| InChIKey | XOMGPHMUVSDQBT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate?
The IUPAC name of [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate (CID 70450695) is [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate.
What is the SMILES notation for [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate?
The canonical SMILES for [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate is CCC(=O)Oc1[nH]c2c(C(F)(F)F)cccc2c(=O)c1C(=O)N(CC)c1nccs1.
What is the InChIKey of [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate?
The InChIKey is XOMGPHMUVSDQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3N3O4S/c1-3-12(26)29-16-13(17(28)25(4-2)18-23-8-9-30-18)15(27)10-6-5-7-11(14(10)24-16)19(20,21)22/h5-9H,3-4H2,1-2H3,(H,24,27).
What are the key properties of [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate?
[3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate has a molecular weight of 439.42 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[ethyl(1,3-thiazol-2-yl)carbamoyl]-4-oxo-8-(trifluoromethyl)-1H-quinolin-2-yl] propanoate is sourced from PubChem (CID 70450695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).