About 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine
1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine (PubChem CID 70450736) has the molecular formula C23H20F3NO
and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine.
Molecular Properties
| Compound Name | 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine |
| PubChem CID | 70450736 |
| Molecular Formula | C23H20F3NO |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine |
| SMILES | CN1CC(Oc2cccc(C(F)(F)F)c2)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20F3NO/c1-27-16-21(28-20-14-8-13-19(15-20)23(24,25)26)22(27,17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3 |
| InChIKey | VOYJZRKKWVRWIL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine?
The IUPAC name of 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine (CID 70450736) is 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine.
What is the SMILES notation for 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine?
The canonical SMILES for 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine is CN1CC(Oc2cccc(C(F)(F)F)c2)C1(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine?
The InChIKey is VOYJZRKKWVRWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F3NO/c1-27-16-21(28-20-14-8-13-19(15-20)23(24,25)26)22(27,17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3.
What are the key properties of 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine?
1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine has a molecular weight of 383.41 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,2-diphenyl-3-[3-(trifluoromethyl)phenoxy]azetidine is sourced from PubChem (CID 70450736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).