About 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate
2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate (PubChem CID 70450898) has the molecular formula C13H12N2O3S
and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate.
Molecular Properties
| Compound Name | 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate |
| PubChem CID | 70450898 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate |
| SMILES | CC1=C(OC(=O)OCCC#N)Sc2ccccc2N1 |
| InChI | InChI=1S/C13H12N2O3S/c1-9-12(18-13(16)17-8-4-7-14)19-11-6-3-2-5-10(11)15-9/h2-3,5-6,15H,4,8H2,1H3 |
| InChIKey | PWWSBPQPVHTFCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate?
The IUPAC name of 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate (CID 70450898) is 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate.
What is the SMILES notation for 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate?
The canonical SMILES for 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate is CC1=C(OC(=O)OCCC#N)Sc2ccccc2N1.
What is the InChIKey of 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate?
The InChIKey is PWWSBPQPVHTFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3S/c1-9-12(18-13(16)17-8-4-7-14)19-11-6-3-2-5-10(11)15-9/h2-3,5-6,15H,4,8H2,1H3.
What are the key properties of 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate?
2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate has a molecular weight of 276.32 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl (3-methyl-4H-1,4-benzothiazin-2-yl) carbonate is sourced from PubChem (CID 70450898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).