C12H11NO5S — CID 70451061
1,1,4-trioxo-2-prop-2-enyl-3H-1λ6,2-benzothiazine-3-carboxylic acid (PubChem CID 70451061) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 1,1,4-trioxo-2-prop-2-enyl-3H-1λ6,2-benzothiazine-3-carboxylic acid.
| Compound Name | 1,1,4-trioxo-2-prop-2-enyl-3H-1λ6,2-benzothiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 70451061 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1,1,4-trioxo-2-prop-2-enyl-3H-1λ6,2-benzothiazine-3-carboxylic acid |
| SMILES | C=CCN1C(C(=O)O)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C12H11NO5S/c1-2-7-13-10(12(15)16)11(14)8-5-3-4-6-9(8)19(13,17)18/h2-6,10H,1,7H2,(H,15,16) |
| InChIKey | NGGPQEOMAIEHMJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|